C7H10BrN3 — CID 126848039
N-(2-bromoethyl)-6-methylpyrimidin-4-amine (PubChem CID 126848039) has the molecular formula C7H10BrN3 and a molecular weight of 216.08 g/mol. Its IUPAC name is N-(2-bromoethyl)-6-methylpyrimidin-4-amine.
| Compound Name | N-(2-bromoethyl)-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 126848039 |
| Molecular Formula | C7H10BrN3 |
| Molecular Weight | 216.08 g/mol |
| Exact Mass | 215.01 |
| IUPAC Name | N-(2-bromoethyl)-6-methylpyrimidin-4-amine |
| SMILES | Cc1cc(NCCBr)ncn1 |
| InChI | InChI=1S/C7H10BrN3/c1-6-4-7(9-3-2-8)11-5-10-6/h4-5H,2-3H2,1H3,(H,9,10,11) |
| InChIKey | NKPZCZWELNTKRN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.08 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|