C15H19N3O — CID 133298580
N-[2-(3,5-dimethylphenoxy)ethyl]-6-methylpyrimidin-4-amine (PubChem CID 133298580) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is N-[2-(3,5-dimethylphenoxy)ethyl]-6-methylpyrimidin-4-amine.
| Compound Name | N-[2-(3,5-dimethylphenoxy)ethyl]-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 133298580 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | N-[2-(3,5-dimethylphenoxy)ethyl]-6-methylpyrimidin-4-amine |
| SMILES | Cc1cc(C)cc(OCCNc2cc(C)ncn2)c1 |
| InChI | InChI=1S/C15H19N3O/c1-11-6-12(2)8-14(7-11)19-5-4-16-15-9-13(3)17-10-18-15/h6-10H,4-5H2,1-3H3,(H,16,17,18) |
| InChIKey | QRGPORHIXCCOJI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|