C14H17N3O3 — CID 82453533
6-methoxy-N-[2-(4-methoxyphenoxy)ethyl]pyrimidin-4-amine (PubChem CID 82453533) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 6-methoxy-N-[2-(4-methoxyphenoxy)ethyl]pyrimidin-4-amine.
| Compound Name | 6-methoxy-N-[2-(4-methoxyphenoxy)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 82453533 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 6-methoxy-N-[2-(4-methoxyphenoxy)ethyl]pyrimidin-4-amine |
| SMILES | COc1ccc(OCCNc2cc(OC)ncn2)cc1 |
| InChI | InChI=1S/C14H17N3O3/c1-18-11-3-5-12(6-4-11)20-8-7-15-13-9-14(19-2)17-10-16-13/h3-6,9-10H,7-8H2,1-2H3,(H,15,16,17) |
| InChIKey | FKFSFZSGMUWETF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|