C21H23ClN4O2 — CID 112862520
6-N-[2-(4-chlorophenyl)ethyl]-4-N-[2-(4-methoxyphenoxy)ethyl]pyrimidine-4,6-diamine (PubChem CID 112862520) has the molecular formula C21H23ClN4O2 and a molecular weight of 398.89 g/mol. Its IUPAC name is 6-N-[2-(4-chlorophenyl)ethyl]-4-N-[2-(4-methoxyphenoxy)ethyl]pyrimidine-4,6-diamine.
| Compound Name | 6-N-[2-(4-chlorophenyl)ethyl]-4-N-[2-(4-methoxyphenoxy)ethyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112862520 |
| Molecular Formula | C21H23ClN4O2 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 6-N-[2-(4-chlorophenyl)ethyl]-4-N-[2-(4-methoxyphenoxy)ethyl]pyrimidine-4,6-diamine |
| SMILES | COc1ccc(OCCNc2cc(NCCc3ccc(Cl)cc3)ncn2)cc1 |
| InChI | InChI=1S/C21H23ClN4O2/c1-27-18-6-8-19(9-7-18)28-13-12-24-21-14-20(25-15-26-21)23-11-10-16-2-4-17(22)5-3-16/h2-9,14-15H,10-13H2,1H3,(H2,23,24,25,26) |
| InChIKey | QNLULZACQMMJFR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|