C9H13N3O2 — CID 61225699
methyl 3-[(6-methylpyrimidin-4-yl)amino]propanoate (PubChem CID 61225699) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is methyl 3-[(6-methylpyrimidin-4-yl)amino]propanoate.
| Compound Name | methyl 3-[(6-methylpyrimidin-4-yl)amino]propanoate |
|---|---|
| PubChem CID | 61225699 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | methyl 3-[(6-methylpyrimidin-4-yl)amino]propanoate |
| SMILES | COC(=O)CCNc1cc(C)ncn1 |
| InChI | InChI=1S/C9H13N3O2/c1-7-5-8(12-6-11-7)10-4-3-9(13)14-2/h5-6H,3-4H2,1-2H3,(H,10,11,12) |
| InChIKey | LEZRJNNACOAIPQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |