C9H14N4O2 — CID 80796856
methyl 3-[(6-amino-5-methylpyrimidin-4-yl)amino]propanoate (PubChem CID 80796856) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is methyl 3-[(6-amino-5-methylpyrimidin-4-yl)amino]propanoate.
| Compound Name | methyl 3-[(6-amino-5-methylpyrimidin-4-yl)amino]propanoate |
|---|---|
| PubChem CID | 80796856 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | methyl 3-[(6-amino-5-methylpyrimidin-4-yl)amino]propanoate |
| SMILES | COC(=O)CCNc1ncnc(N)c1C |
| InChI | InChI=1S/C9H14N4O2/c1-6-8(10)12-5-13-9(6)11-4-3-7(14)15-2/h5H,3-4H2,1-2H3,(H3,10,11,12,13) |
| InChIKey | IUDPUYVVGWXTAO-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |