C11H17N3O3 — CID 66326780
methyl 3-[(6-ethoxy-5-methylpyrimidin-4-yl)amino]propanoate (PubChem CID 66326780) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is methyl 3-[(6-ethoxy-5-methylpyrimidin-4-yl)amino]propanoate.
| Compound Name | methyl 3-[(6-ethoxy-5-methylpyrimidin-4-yl)amino]propanoate |
|---|---|
| PubChem CID | 66326780 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | methyl 3-[(6-ethoxy-5-methylpyrimidin-4-yl)amino]propanoate |
| SMILES | CCOc1ncnc(NCCC(=O)OC)c1C |
| InChI | InChI=1S/C11H17N3O3/c1-4-17-11-8(2)10(13-7-14-11)12-6-5-9(15)16-3/h7H,4-6H2,1-3H3,(H,12,13,14) |
| InChIKey | PSDOSVWJVHZUPI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |