C10H13N3O — CID 66326862
6-ethoxy-5-methyl-N-prop-2-ynylpyrimidin-4-amine (PubChem CID 66326862) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 6-ethoxy-5-methyl-N-prop-2-ynylpyrimidin-4-amine.
| Compound Name | 6-ethoxy-5-methyl-N-prop-2-ynylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66326862 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 6-ethoxy-5-methyl-N-prop-2-ynylpyrimidin-4-amine |
| SMILES | C#CCNc1ncnc(OCC)c1C |
| InChI | InChI=1S/C10H13N3O/c1-4-6-11-9-8(3)10(14-5-2)13-7-12-9/h1,7H,5-6H2,2-3H3,(H,11,12,13) |
| InChIKey | BBOQMMVPKCUUAC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|