C8H12N4O2 — CID 79918514
methyl 3-[(5-aminopyrimidin-4-yl)amino]propanoate (PubChem CID 79918514) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is methyl 3-[(5-aminopyrimidin-4-yl)amino]propanoate.
| Compound Name | methyl 3-[(5-aminopyrimidin-4-yl)amino]propanoate |
|---|---|
| PubChem CID | 79918514 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | methyl 3-[(5-aminopyrimidin-4-yl)amino]propanoate |
| SMILES | COC(=O)CCNc1ncncc1N |
| InChI | InChI=1S/C8H12N4O2/c1-14-7(13)2-3-11-8-6(9)4-10-5-12-8/h4-5H,2-3,9H2,1H3,(H,10,11,12) |
| InChIKey | ASJJHLAMZGMWJU-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |