C7H10N4O2 — CID 79908313
methyl 2-[(5-aminopyrimidin-4-yl)amino]acetate (PubChem CID 79908313) has the molecular formula C7H10N4O2 and a molecular weight of 182.18 g/mol. Its IUPAC name is methyl 2-[(5-aminopyrimidin-4-yl)amino]acetate.
| Compound Name | methyl 2-[(5-aminopyrimidin-4-yl)amino]acetate |
|---|---|
| PubChem CID | 79908313 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | methyl 2-[(5-aminopyrimidin-4-yl)amino]acetate |
| SMILES | COC(=O)CNc1ncncc1N |
| InChI | InChI=1S/C7H10N4O2/c1-13-6(12)3-10-7-5(8)2-9-4-11-7/h2,4H,3,8H2,1H3,(H,9,10,11) |
| InChIKey | WHSXGQYDMRRDGO-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |