C7H10N4O2 — CID 130543339
2-[(5-methoxypyrimidin-4-yl)amino]acetamide (PubChem CID 130543339) has the molecular formula C7H10N4O2 and a molecular weight of 182.18 g/mol. Its IUPAC name is 2-[(5-methoxypyrimidin-4-yl)amino]acetamide.
| Compound Name | 2-[(5-methoxypyrimidin-4-yl)amino]acetamide |
|---|---|
| PubChem CID | 130543339 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 2-[(5-methoxypyrimidin-4-yl)amino]acetamide |
| SMILES | COc1cncnc1NCC(N)=O |
| InChI | InChI=1S/C7H10N4O2/c1-13-5-2-9-4-11-7(5)10-3-6(8)12/h2,4H,3H2,1H3,(H2,8,12)(H,9,10,11) |
| InChIKey | GUWBHUNRLZMAQZ-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |