C7H9F2N3O — CID 130543368
N-(2,2-difluoroethyl)-5-methoxypyrimidin-4-amine (PubChem CID 130543368) has the molecular formula C7H9F2N3O and a molecular weight of 189.17 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-5-methoxypyrimidin-4-amine.
| Compound Name | N-(2,2-difluoroethyl)-5-methoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 130543368 |
| Molecular Formula | C7H9F2N3O |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | N-(2,2-difluoroethyl)-5-methoxypyrimidin-4-amine |
| SMILES | COc1cncnc1NCC(F)F |
| InChI | InChI=1S/C7H9F2N3O/c1-13-5-2-10-4-12-7(5)11-3-6(8)9/h2,4,6H,3H2,1H3,(H,10,11,12) |
| InChIKey | PBLWEPRQAKJADM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |