C7H8ClF2N3O — CID 169119413
2-chloro-N-(2,2-difluoroethyl)-5-methoxypyrimidin-4-amine (PubChem CID 169119413) has the molecular formula C7H8ClF2N3O and a molecular weight of 223.61 g/mol. Its IUPAC name is 2-chloro-N-(2,2-difluoroethyl)-5-methoxypyrimidin-4-amine.
| Compound Name | 2-chloro-N-(2,2-difluoroethyl)-5-methoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 169119413 |
| Molecular Formula | C7H8ClF2N3O |
| Molecular Weight | 223.61 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 2-chloro-N-(2,2-difluoroethyl)-5-methoxypyrimidin-4-amine |
| SMILES | COc1cnc(Cl)nc1NCC(F)F |
| InChI | InChI=1S/C7H8ClF2N3O/c1-14-4-2-12-7(8)13-6(4)11-3-5(9)10/h2,5H,3H2,1H3,(H,11,12,13) |
| InChIKey | MGWHAEASEOSMAZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.61 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |