C7H7ClN4O3S — CID 89297706
(2-chloro-5-methoxypyrimidin-4-yl)carbamothioylcarbamic acid (PubChem CID 89297706) has the molecular formula C7H7ClN4O3S and a molecular weight of 262.68 g/mol. Its IUPAC name is (2-chloro-5-methoxypyrimidin-4-yl)carbamothioylcarbamic acid.
| Compound Name | (2-chloro-5-methoxypyrimidin-4-yl)carbamothioylcarbamic acid |
|---|---|
| PubChem CID | 89297706 |
| Molecular Formula | C7H7ClN4O3S |
| Molecular Weight | 262.68 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | (2-chloro-5-methoxypyrimidin-4-yl)carbamothioylcarbamic acid |
| SMILES | COc1cnc(Cl)nc1NC(=S)NC(=O)O |
| InChI | InChI=1S/C7H7ClN4O3S/c1-15-3-2-9-5(8)10-4(3)11-6(16)12-7(13)14/h2H,1H3,(H,13,14)(H2,9,10,11,12,16) |
| InChIKey | OGLKRJYKATZOHQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.68 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|