C13H12Cl2N4O2 — CID 154628189
2-chloro-4-[(5-chloro-2-methoxyphenyl)methylamino]pyrimidine-5-carboxamide (PubChem CID 154628189) has the molecular formula C13H12Cl2N4O2 and a molecular weight of 327.17 g/mol. Its IUPAC name is 2-chloro-4-[(5-chloro-2-methoxyphenyl)methylamino]pyrimidine-5-carboxamide.
| Compound Name | 2-chloro-4-[(5-chloro-2-methoxyphenyl)methylamino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 154628189 |
| Molecular Formula | C13H12Cl2N4O2 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 2-chloro-4-[(5-chloro-2-methoxyphenyl)methylamino]pyrimidine-5-carboxamide |
| SMILES | COc1ccc(Cl)cc1CNc1nc(Cl)ncc1C(N)=O |
| InChI | InChI=1S/C13H12Cl2N4O2/c1-21-10-3-2-8(14)4-7(10)5-17-12-9(11(16)20)6-18-13(15)19-12/h2-4,6H,5H2,1H3,(H2,16,20)(H,17,18,19) |
| InChIKey | QUIMNVWTGALXBL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |