C13H13ClN2O — CID 54905217
N-[(5-chloro-2-methoxyphenyl)methyl]pyridin-3-amine (PubChem CID 54905217) has the molecular formula C13H13ClN2O and a molecular weight of 248.71 g/mol. Its IUPAC name is N-[(5-chloro-2-methoxyphenyl)methyl]pyridin-3-amine.
| Compound Name | N-[(5-chloro-2-methoxyphenyl)methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 54905217 |
| Molecular Formula | C13H13ClN2O |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | N-[(5-chloro-2-methoxyphenyl)methyl]pyridin-3-amine |
| SMILES | COc1ccc(Cl)cc1CNc1cccnc1 |
| InChI | InChI=1S/C13H13ClN2O/c1-17-13-5-4-11(14)7-10(13)8-16-12-3-2-6-15-9-12/h2-7,9,16H,8H2,1H3 |
| InChIKey | PKSPYVRLKQTPQF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |