C12H12Cl4N2 — CID 71432381
N-[(2,4-dichlorophenyl)methyl]pyridin-3-amine;dihydrochloride (PubChem CID 71432381) has the molecular formula C12H12Cl4N2 and a molecular weight of 326.05 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]pyridin-3-amine;dihydrochloride.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]pyridin-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 71432381 |
| Molecular Formula | C12H12Cl4N2 |
| Molecular Weight | 326.05 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]pyridin-3-amine;dihydrochloride |
| SMILES | Cl.Cl.Clc1ccc(CNc2cccnc2)c(Cl)c1 |
| InChI | InChI=1S/C12H10Cl2N2.2ClH/c13-10-4-3-9(12(14)6-10)7-16-11-2-1-5-15-8-11;;/h1-6,8,16H,7H2;2*1H |
| InChIKey | LUJWTGAPICNZCX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.05 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |