C13H9Cl4N — CID 13339999
2,4-dichloro-N-[(2,4-dichlorophenyl)methyl]aniline (PubChem CID 13339999) has the molecular formula C13H9Cl4N and a molecular weight of 321.03 g/mol. Its IUPAC name is 2,4-dichloro-N-[(2,4-dichlorophenyl)methyl]aniline.
| Compound Name | 2,4-dichloro-N-[(2,4-dichlorophenyl)methyl]aniline |
|---|---|
| PubChem CID | 13339999 |
| Molecular Formula | C13H9Cl4N |
| Molecular Weight | 321.03 g/mol |
| Exact Mass | 318.95 |
| IUPAC Name | 2,4-dichloro-N-[(2,4-dichlorophenyl)methyl]aniline |
| SMILES | Clc1ccc(CNc2ccc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H9Cl4N/c14-9-2-1-8(11(16)5-9)7-18-13-4-3-10(15)6-12(13)17/h1-6,18H,7H2 |
| InChIKey | HJWYDVJKSDHDSL-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.03 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |