About 2-chloro-N-[(4-imidazo[1,2-a]pyrazin-8-ylphenyl)methyl]-5-methoxypyrimidin-4-amine
2-chloro-N-[(4-imidazo[1,2-a]pyrazin-8-ylphenyl)methyl]-5-methoxypyrimidin-4-amine (PubChem CID 170316954) has the molecular formula C18H15ClN6O
and a molecular weight of 366.81 g/mol. Its IUPAC name is 2-chloro-N-[(4-imidazo[1,2-a]pyrazin-8-ylphenyl)methyl]-5-methoxypyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-chloro-N-[(4-imidazo[1,2-a]pyrazin-8-ylphenyl)methyl]-5-methoxypyrimidin-4-amine |
| PubChem CID | 170316954 |
| Molecular Formula | C18H15ClN6O |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 2-chloro-N-[(4-imidazo[1,2-a]pyrazin-8-ylphenyl)methyl]-5-methoxypyrimidin-4-amine |
| SMILES | COc1cnc(Cl)nc1NCc1ccc(-c2nccn3ccnc23)cc1 |
| InChI | InChI=1S/C18H15ClN6O/c1-26-14-11-23-18(19)24-16(14)22-10-12-2-4-13(5-3-12)15-17-21-7-9-25(17)8-6-20-15/h2-9,11H,10H2,1H3,(H,22,23,24) |
| InChIKey | YFSFGSAHZPSUAL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-chloro-N-[(4-imidazo[1,2-a]pyrazin-8-ylphenyl)methyl]-5-methoxypyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[(4-imidazo[1,2-a]pyrazin-8-ylphenyl)methyl]-5-methoxypyrimidin-4-amine?
The IUPAC name of 2-chloro-N-[(4-imidazo[1,2-a]pyrazin-8-ylphenyl)methyl]-5-methoxypyrimidin-4-amine (CID 170316954) is 2-chloro-N-[(4-imidazo[1,2-a]pyrazin-8-ylphenyl)methyl]-5-methoxypyrimidin-4-amine.
What is the SMILES notation for 2-chloro-N-[(4-imidazo[1,2-a]pyrazin-8-ylphenyl)methyl]-5-methoxypyrimidin-4-amine?
The canonical SMILES for 2-chloro-N-[(4-imidazo[1,2-a]pyrazin-8-ylphenyl)methyl]-5-methoxypyrimidin-4-amine is COc1cnc(Cl)nc1NCc1ccc(-c2nccn3ccnc23)cc1.
What is the InChIKey of 2-chloro-N-[(4-imidazo[1,2-a]pyrazin-8-ylphenyl)methyl]-5-methoxypyrimidin-4-amine?
The InChIKey is YFSFGSAHZPSUAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15ClN6O/c1-26-14-11-23-18(19)24-16(14)22-10-12-2-4-13(5-3-12)15-17-21-7-9-25(17)8-6-20-15/h2-9,11H,10H2,1H3,(H,22,23,24).
What are the key properties of 2-chloro-N-[(4-imidazo[1,2-a]pyrazin-8-ylphenyl)methyl]-5-methoxypyrimidin-4-amine?
2-chloro-N-[(4-imidazo[1,2-a]pyrazin-8-ylphenyl)methyl]-5-methoxypyrimidin-4-amine has a molecular weight of 366.81 g/mol, XLogP of 3.46, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[(4-imidazo[1,2-a]pyrazin-8-ylphenyl)methyl]-5-methoxypyrimidin-4-amine is sourced from PubChem (CID 170316954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).