C14H12ClN5O — CID 82459612
2-chloro-N-[(4-methoxyphenyl)methyl]pteridin-4-amine (PubChem CID 82459612) has the molecular formula C14H12ClN5O and a molecular weight of 301.74 g/mol. Its IUPAC name is 2-chloro-N-[(4-methoxyphenyl)methyl]pteridin-4-amine.
| Compound Name | 2-chloro-N-[(4-methoxyphenyl)methyl]pteridin-4-amine |
|---|---|
| PubChem CID | 82459612 |
| Molecular Formula | C14H12ClN5O |
| Molecular Weight | 301.74 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-chloro-N-[(4-methoxyphenyl)methyl]pteridin-4-amine |
| SMILES | COc1ccc(CNc2nc(Cl)nc3nccnc23)cc1 |
| InChI | InChI=1S/C14H12ClN5O/c1-21-10-4-2-9(3-5-10)8-18-13-11-12(17-7-6-16-11)19-14(15)20-13/h2-7H,8H2,1H3,(H,17,18,19,20) |
| InChIKey | AJGXACVAJFSNLL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.74 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |