C15H15N5O — CID 58174186
N-[2-(4-methoxyphenyl)ethyl]pteridin-4-amine (PubChem CID 58174186) has the molecular formula C15H15N5O and a molecular weight of 281.32 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]pteridin-4-amine.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]pteridin-4-amine |
|---|---|
| PubChem CID | 58174186 |
| Molecular Formula | C15H15N5O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]pteridin-4-amine |
| SMILES | COc1ccc(CCNc2ncnc3nccnc23)cc1 |
| InChI | InChI=1S/C15H15N5O/c1-21-12-4-2-11(3-5-12)6-7-17-14-13-15(20-10-19-14)18-9-8-16-13/h2-5,8-10H,6-7H2,1H3,(H,17,18,19,20) |
| InChIKey | BURKOEYMCKVBBT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |