C43H40N10O3 — CID 161366630
N-[2-[4-[2-(4-phenylmethoxyphenyl)ethoxy]phenyl]ethyl]pteridin-4-amine;4-[2-(pteridin-4-ylamino)ethyl]phenol (PubChem CID 161366630) has the molecular formula C43H40N10O3 and a molecular weight of 744.86 g/mol. Its IUPAC name is N-[2-[4-[2-(4-phenylmethoxyphenyl)ethoxy]phenyl]ethyl]pteridin-4-amine;4-[2-(pteridin-4-ylamino)ethyl]phenol.
| Compound Name | N-[2-[4-[2-(4-phenylmethoxyphenyl)ethoxy]phenyl]ethyl]pteridin-4-amine;4-[2-(pteridin-4-ylamino)ethyl]phenol |
|---|---|
| PubChem CID | 161366630 |
| Molecular Formula | C43H40N10O3 |
| Molecular Weight | 744.86 g/mol |
| Exact Mass | 744.33 |
| IUPAC Name | N-[2-[4-[2-(4-phenylmethoxyphenyl)ethoxy]phenyl]ethyl]pteridin-4-amine;4-[2-(pteridin-4-ylamino)ethyl]phenol |
| SMILES | Oc1ccc(CCNc2ncnc3nccnc23)cc1.c1ccc(COc2ccc(CCOc3ccc(CCNc4ncnc5nccnc45)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H27N5O2.C14H13N5O/c1-2-4-24(5-3-1)20-36-26-12-8-23(9-13-26)15-19-35-25-10-6-22(7-11-25)14-16-31-28-27-29(34-21-33-28)32-18-17-30-27;20-11-3-1-10(2-4-11)5-6-16-13-12-14(19-9-18-13)17-8-7-15-12/h1-13,17-18,21H,14-16,19-20H2,(H,31,32,33,34);1-4,7-9,20H,5-6H2,(H,16,17,18,19) |
| InChIKey | VPWZEZRMPMPDAS-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 165.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.86 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |