C20H14ClF3N6O — CID 58174236
N-[2-[4-[[2-chloro-4-(trifluoromethyl)-3-pyridinyl]oxy]phenyl]ethyl]pteridin-4-amine (PubChem CID 58174236) has the molecular formula C20H14ClF3N6O and a molecular weight of 446.82 g/mol. Its IUPAC name is N-[2-[4-[[2-chloro-4-(trifluoromethyl)-3-pyridinyl]oxy]phenyl]ethyl]pteridin-4-amine.
| Compound Name | N-[2-[4-[[2-chloro-4-(trifluoromethyl)-3-pyridinyl]oxy]phenyl]ethyl]pteridin-4-amine |
|---|---|
| PubChem CID | 58174236 |
| Molecular Formula | C20H14ClF3N6O |
| Molecular Weight | 446.82 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | N-[2-[4-[[2-chloro-4-(trifluoromethyl)-3-pyridinyl]oxy]phenyl]ethyl]pteridin-4-amine |
| SMILES | FC(F)(F)c1ccnc(Cl)c1Oc1ccc(CCNc2ncnc3nccnc23)cc1 |
| InChI | InChI=1S/C20H14ClF3N6O/c21-17-16(14(6-8-26-17)20(22,23)24)31-13-3-1-12(2-4-13)5-7-27-18-15-19(30-11-29-18)28-10-9-25-15/h1-4,6,8-11H,5,7H2,(H,27,28,29,30) |
| InChIKey | XDWAGTBFKVPPOJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 85.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.82 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|