C19H15IN6O — CID 58174149
N-[2-[3-[(4-iodo-2-pyridinyl)oxy]phenyl]ethyl]pteridin-4-amine (PubChem CID 58174149) has the molecular formula C19H15IN6O and a molecular weight of 470.27 g/mol. Its IUPAC name is N-[2-[3-[(4-iodo-2-pyridinyl)oxy]phenyl]ethyl]pteridin-4-amine.
| Compound Name | N-[2-[3-[(4-iodo-2-pyridinyl)oxy]phenyl]ethyl]pteridin-4-amine |
|---|---|
| PubChem CID | 58174149 |
| Molecular Formula | C19H15IN6O |
| Molecular Weight | 470.27 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | N-[2-[3-[(4-iodo-2-pyridinyl)oxy]phenyl]ethyl]pteridin-4-amine |
| SMILES | Ic1ccnc(Oc2cccc(CCNc3ncnc4nccnc34)c2)c1 |
| InChI | InChI=1S/C19H15IN6O/c20-14-5-7-21-16(11-14)27-15-3-1-2-13(10-15)4-6-23-18-17-19(26-12-25-18)24-9-8-22-17/h1-3,5,7-12H,4,6H2,(H,23,24,25,26) |
| InChIKey | GZNSQSLYOIJJPU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 85.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.27 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|