C20H14ClN7O — CID 58174231
3-chloro-5-[3-[2-(pteridin-4-ylamino)ethyl]phenoxy]pyridine-4-carbonitrile (PubChem CID 58174231) has the molecular formula C20H14ClN7O and a molecular weight of 403.83 g/mol. Its IUPAC name is 3-chloro-5-[3-[2-(pteridin-4-ylamino)ethyl]phenoxy]pyridine-4-carbonitrile.
| Compound Name | 3-chloro-5-[3-[2-(pteridin-4-ylamino)ethyl]phenoxy]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 58174231 |
| Molecular Formula | C20H14ClN7O |
| Molecular Weight | 403.83 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 3-chloro-5-[3-[2-(pteridin-4-ylamino)ethyl]phenoxy]pyridine-4-carbonitrile |
| SMILES | N#Cc1c(Cl)cncc1Oc1cccc(CCNc2ncnc3nccnc23)c1 |
| InChI | InChI=1S/C20H14ClN7O/c21-16-10-23-11-17(15(16)9-22)29-14-3-1-2-13(8-14)4-5-25-19-18-20(28-12-27-19)26-7-6-24-18/h1-3,6-8,10-12H,4-5H2,(H,25,26,27,28) |
| InChIKey | RZKSRGHATHGJLV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.83 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |