C21H20N6O — CID 139981850
4-N-[2-[3-(pyrazin-2-ylmethoxy)phenyl]ethyl]quinazoline-4,6-diamine (PubChem CID 139981850) has the molecular formula C21H20N6O and a molecular weight of 372.43 g/mol. Its IUPAC name is 4-N-[2-[3-(pyrazin-2-ylmethoxy)phenyl]ethyl]quinazoline-4,6-diamine.
| Compound Name | 4-N-[2-[3-(pyrazin-2-ylmethoxy)phenyl]ethyl]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 139981850 |
| Molecular Formula | C21H20N6O |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 4-N-[2-[3-(pyrazin-2-ylmethoxy)phenyl]ethyl]quinazoline-4,6-diamine |
| SMILES | Nc1ccc2ncnc(NCCc3cccc(OCc4cnccn4)c3)c2c1 |
| InChI | InChI=1S/C21H20N6O/c22-16-4-5-20-19(11-16)21(27-14-26-20)25-7-6-15-2-1-3-18(10-15)28-13-17-12-23-8-9-24-17/h1-5,8-12,14H,6-7,13,22H2,(H,25,26,27) |
| InChIKey | COSOLASWNCGNDK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|