C20H24N4O — CID 139981855
4-N-[2-(3-butan-2-yloxyphenyl)ethyl]quinazoline-4,6-diamine (PubChem CID 139981855) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 4-N-[2-(3-butan-2-yloxyphenyl)ethyl]quinazoline-4,6-diamine.
| Compound Name | 4-N-[2-(3-butan-2-yloxyphenyl)ethyl]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 139981855 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 4-N-[2-(3-butan-2-yloxyphenyl)ethyl]quinazoline-4,6-diamine |
| SMILES | CCC(C)Oc1cccc(CCNc2ncnc3ccc(N)cc23)c1 |
| InChI | InChI=1S/C20H24N4O/c1-3-14(2)25-17-6-4-5-15(11-17)9-10-22-20-18-12-16(21)7-8-19(18)23-13-24-20/h4-8,11-14H,3,9-10,21H2,1-2H3,(H,22,23,24) |
| InChIKey | FTMKJSWZFPDLBX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|