C22H22N4OS — CID 139981796
4-N-[2-[3-[(5-methylthiophen-2-yl)methoxy]phenyl]ethyl]quinazoline-4,6-diamine (PubChem CID 139981796) has the molecular formula C22H22N4OS and a molecular weight of 390.51 g/mol. Its IUPAC name is 4-N-[2-[3-[(5-methylthiophen-2-yl)methoxy]phenyl]ethyl]quinazoline-4,6-diamine.
| Compound Name | 4-N-[2-[3-[(5-methylthiophen-2-yl)methoxy]phenyl]ethyl]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 139981796 |
| Molecular Formula | C22H22N4OS |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 4-N-[2-[3-[(5-methylthiophen-2-yl)methoxy]phenyl]ethyl]quinazoline-4,6-diamine |
| SMILES | Cc1ccc(COc2cccc(CCNc3ncnc4ccc(N)cc34)c2)s1 |
| InChI | InChI=1S/C22H22N4OS/c1-15-5-7-19(28-15)13-27-18-4-2-3-16(11-18)9-10-24-22-20-12-17(23)6-8-21(20)25-14-26-22/h2-8,11-12,14H,9-10,13,23H2,1H3,(H,24,25,26) |
| InChIKey | DRUFXPVBQXVWMQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|