C19H22N4O — CID 139981922
4-N-[2-(3-propoxyphenyl)ethyl]quinazoline-4,6-diamine (PubChem CID 139981922) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is 4-N-[2-(3-propoxyphenyl)ethyl]quinazoline-4,6-diamine.
| Compound Name | 4-N-[2-(3-propoxyphenyl)ethyl]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 139981922 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 4-N-[2-(3-propoxyphenyl)ethyl]quinazoline-4,6-diamine |
| SMILES | CCCOc1cccc(CCNc2ncnc3ccc(N)cc23)c1 |
| InChI | InChI=1S/C19H22N4O/c1-2-10-24-16-5-3-4-14(11-16)8-9-21-19-17-12-15(20)6-7-18(17)22-13-23-19/h3-7,11-13H,2,8-10,20H2,1H3,(H,21,22,23) |
| InChIKey | WZBNQIKDLQGKTE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|