C21H26N4O — CID 139981790
4-N-[2-[4-(3-methylbutoxy)phenyl]ethyl]quinazoline-4,6-diamine (PubChem CID 139981790) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is 4-N-[2-[4-(3-methylbutoxy)phenyl]ethyl]quinazoline-4,6-diamine.
| Compound Name | 4-N-[2-[4-(3-methylbutoxy)phenyl]ethyl]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 139981790 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 4-N-[2-[4-(3-methylbutoxy)phenyl]ethyl]quinazoline-4,6-diamine |
| SMILES | CC(C)CCOc1ccc(CCNc2ncnc3ccc(N)cc23)cc1 |
| InChI | InChI=1S/C21H26N4O/c1-15(2)10-12-26-18-6-3-16(4-7-18)9-11-23-21-19-13-17(22)5-8-20(19)24-14-25-21/h3-8,13-15H,9-12,22H2,1-2H3,(H,23,24,25) |
| InChIKey | DLUDKJCESICWCT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|