C18H18ClN3O — CID 23631998
6-chloro-N-[2-(4-ethoxyphenyl)ethyl]quinazolin-4-amine (PubChem CID 23631998) has the molecular formula C18H18ClN3O and a molecular weight of 327.82 g/mol. Its IUPAC name is 6-chloro-N-[2-(4-ethoxyphenyl)ethyl]quinazolin-4-amine.
| Compound Name | 6-chloro-N-[2-(4-ethoxyphenyl)ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 23631998 |
| Molecular Formula | C18H18ClN3O |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 6-chloro-N-[2-(4-ethoxyphenyl)ethyl]quinazolin-4-amine |
| SMILES | CCOc1ccc(CCNc2ncnc3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C18H18ClN3O/c1-2-23-15-6-3-13(4-7-15)9-10-20-18-16-11-14(19)5-8-17(16)21-12-22-18/h3-8,11-12H,2,9-10H2,1H3,(H,20,21,22) |
| InChIKey | CCCTWRDOOCXIGU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |