C21H19N5O — CID 139981848
4-N-[2-(4-pyridin-4-yloxyphenyl)ethyl]quinazoline-4,6-diamine (PubChem CID 139981848) has the molecular formula C21H19N5O and a molecular weight of 357.42 g/mol. Its IUPAC name is 4-N-[2-(4-pyridin-4-yloxyphenyl)ethyl]quinazoline-4,6-diamine.
| Compound Name | 4-N-[2-(4-pyridin-4-yloxyphenyl)ethyl]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 139981848 |
| Molecular Formula | C21H19N5O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 4-N-[2-(4-pyridin-4-yloxyphenyl)ethyl]quinazoline-4,6-diamine |
| SMILES | Nc1ccc2ncnc(NCCc3ccc(Oc4ccncc4)cc3)c2c1 |
| InChI | InChI=1S/C21H19N5O/c22-16-3-6-20-19(13-16)21(26-14-25-20)24-12-7-15-1-4-17(5-2-15)27-18-8-10-23-11-9-18/h1-6,8-11,13-14H,7,12,22H2,(H,24,25,26) |
| InChIKey | DJZROPDBDUMDMQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|