C44H36N8O6 — CID 175100057
6-nitro-N-[2-(4-phenoxyphenyl)ethyl]quinazolin-4-amine (PubChem CID 175100057) has the molecular formula C44H36N8O6 and a molecular weight of 772.82 g/mol. Its IUPAC name is 6-nitro-N-[2-(4-phenoxyphenyl)ethyl]quinazolin-4-amine.
| Compound Name | 6-nitro-N-[2-(4-phenoxyphenyl)ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 175100057 |
| Molecular Formula | C44H36N8O6 |
| Molecular Weight | 772.82 g/mol |
| Exact Mass | 772.28 |
| IUPAC Name | 6-nitro-N-[2-(4-phenoxyphenyl)ethyl]quinazolin-4-amine |
| SMILES | O=[N+]([O-])c1ccc2ncnc(NCCc3ccc(Oc4ccccc4)cc3)c2c1.O=[N+]([O-])c1ccc2ncnc(NCCc3ccc(Oc4ccccc4)cc3)c2c1 |
| InChI | InChI=1S/2C22H18N4O3/c2*27-26(28)17-8-11-21-20(14-17)22(25-15-24-21)23-13-12-16-6-9-19(10-7-16)29-18-4-2-1-3-5-18/h2*1-11,14-15H,12-13H2,(H,23,24,25) |
| InChIKey | RUYOLKLCHOTGDI-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 180.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.82 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|