C23H22N4O2 — CID 139981946
4-N-[2-[3-(4-methoxyphenoxy)phenyl]ethyl]quinazoline-4,6-diamine (PubChem CID 139981946) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 4-N-[2-[3-(4-methoxyphenoxy)phenyl]ethyl]quinazoline-4,6-diamine.
| Compound Name | 4-N-[2-[3-(4-methoxyphenoxy)phenyl]ethyl]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 139981946 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 4-N-[2-[3-(4-methoxyphenoxy)phenyl]ethyl]quinazoline-4,6-diamine |
| SMILES | COc1ccc(Oc2cccc(CCNc3ncnc4ccc(N)cc34)c2)cc1 |
| InChI | InChI=1S/C23H22N4O2/c1-28-18-6-8-19(9-7-18)29-20-4-2-3-16(13-20)11-12-25-23-21-14-17(24)5-10-22(21)26-15-27-23/h2-10,13-15H,11-12,24H2,1H3,(H,25,26,27) |
| InChIKey | BHNFXQNKFBSISG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|