C20H22N4O — CID 139981937
4-N-[2-(4-but-3-enoxyphenyl)ethyl]quinazoline-4,6-diamine (PubChem CID 139981937) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-N-[2-(4-but-3-enoxyphenyl)ethyl]quinazoline-4,6-diamine.
| Compound Name | 4-N-[2-(4-but-3-enoxyphenyl)ethyl]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 139981937 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 4-N-[2-(4-but-3-enoxyphenyl)ethyl]quinazoline-4,6-diamine |
| SMILES | C=CCCOc1ccc(CCNc2ncnc3ccc(N)cc23)cc1 |
| InChI | InChI=1S/C20H22N4O/c1-2-3-12-25-17-7-4-15(5-8-17)10-11-22-20-18-13-16(21)6-9-19(18)23-14-24-20/h2,4-9,13-14H,1,3,10-12,21H2,(H,22,23,24) |
| InChIKey | PLPDZIIAPQINKQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|