C18H15ClF3N3O — CID 19751395
6-chloro-N-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]quinazolin-4-amine (PubChem CID 19751395) has the molecular formula C18H15ClF3N3O and a molecular weight of 381.79 g/mol. Its IUPAC name is 6-chloro-N-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]quinazolin-4-amine.
| Compound Name | 6-chloro-N-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 19751395 |
| Molecular Formula | C18H15ClF3N3O |
| Molecular Weight | 381.79 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 6-chloro-N-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]quinazolin-4-amine |
| SMILES | FC(F)(F)COc1ccc(CCNc2ncnc3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C18H15ClF3N3O/c19-13-3-6-16-15(9-13)17(25-11-24-16)23-8-7-12-1-4-14(5-2-12)26-10-18(20,21)22/h1-6,9,11H,7-8,10H2,(H,23,24,25) |
| InChIKey | RAJBGTMFJPHYRK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.79 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |