C17H13FN4 — CID 86305930
4-[2-[(6-fluoroquinazolin-4-yl)amino]ethyl]benzonitrile (PubChem CID 86305930) has the molecular formula C17H13FN4 and a molecular weight of 292.32 g/mol. Its IUPAC name is 4-[2-[(6-fluoroquinazolin-4-yl)amino]ethyl]benzonitrile.
| Compound Name | 4-[2-[(6-fluoroquinazolin-4-yl)amino]ethyl]benzonitrile |
|---|---|
| PubChem CID | 86305930 |
| Molecular Formula | C17H13FN4 |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4-[2-[(6-fluoroquinazolin-4-yl)amino]ethyl]benzonitrile |
| SMILES | N#Cc1ccc(CCNc2ncnc3ccc(F)cc23)cc1 |
| InChI | InChI=1S/C17H13FN4/c18-14-5-6-16-15(9-14)17(22-11-21-16)20-8-7-12-1-3-13(10-19)4-2-12/h1-6,9,11H,7-8H2,(H,20,21,22) |
| InChIKey | VJXRMKROLIMWDH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |