C16H12F3N3 — CID 91642669
N-[2-(2,3-difluorophenyl)ethyl]-6-fluoroquinazolin-4-amine (PubChem CID 91642669) has the molecular formula C16H12F3N3 and a molecular weight of 303.29 g/mol. Its IUPAC name is N-[2-(2,3-difluorophenyl)ethyl]-6-fluoroquinazolin-4-amine.
| Compound Name | N-[2-(2,3-difluorophenyl)ethyl]-6-fluoroquinazolin-4-amine |
|---|---|
| PubChem CID | 91642669 |
| Molecular Formula | C16H12F3N3 |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-[2-(2,3-difluorophenyl)ethyl]-6-fluoroquinazolin-4-amine |
| SMILES | Fc1ccc2ncnc(NCCc3cccc(F)c3F)c2c1 |
| InChI | InChI=1S/C16H12F3N3/c17-11-4-5-14-12(8-11)16(22-9-21-14)20-7-6-10-2-1-3-13(18)15(10)19/h1-5,8-9H,6-7H2,(H,20,21,22) |
| InChIKey | BOKSVNSQEGBEKR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |