C18H15FN4 — CID 133278314
N-[2-(6-fluoro-1H-indol-3-yl)ethyl]quinazolin-4-amine (PubChem CID 133278314) has the molecular formula C18H15FN4 and a molecular weight of 306.34 g/mol. Its IUPAC name is N-[2-(6-fluoro-1H-indol-3-yl)ethyl]quinazolin-4-amine.
| Compound Name | N-[2-(6-fluoro-1H-indol-3-yl)ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 133278314 |
| Molecular Formula | C18H15FN4 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | N-[2-(6-fluoro-1H-indol-3-yl)ethyl]quinazolin-4-amine |
| SMILES | Fc1ccc2c(CCNc3ncnc4ccccc34)c[nH]c2c1 |
| InChI | InChI=1S/C18H15FN4/c19-13-5-6-14-12(10-21-17(14)9-13)7-8-20-18-15-3-1-2-4-16(15)22-11-23-18/h1-6,9-11,21H,7-8H2,(H,20,22,23) |
| InChIKey | MJKOFFMZVMGYCC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |