C15H13ClFN3 — CID 133360584
2-chloro-N-[2-(6-fluoro-1H-indol-3-yl)ethyl]pyridin-4-amine (PubChem CID 133360584) has the molecular formula C15H13ClFN3 and a molecular weight of 289.74 g/mol. Its IUPAC name is 2-chloro-N-[2-(6-fluoro-1H-indol-3-yl)ethyl]pyridin-4-amine.
| Compound Name | 2-chloro-N-[2-(6-fluoro-1H-indol-3-yl)ethyl]pyridin-4-amine |
|---|---|
| PubChem CID | 133360584 |
| Molecular Formula | C15H13ClFN3 |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 2-chloro-N-[2-(6-fluoro-1H-indol-3-yl)ethyl]pyridin-4-amine |
| SMILES | Fc1ccc2c(CCNc3ccnc(Cl)c3)c[nH]c2c1 |
| InChI | InChI=1S/C15H13ClFN3/c16-15-8-12(4-6-19-15)18-5-3-10-9-20-14-7-11(17)1-2-13(10)14/h1-2,4,6-9,20H,3,5H2,(H,18,19) |
| InChIKey | GGKYDYMFNUOGNN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|