C18H15ClN4 — CID 22692794
2-chloro-N-[2-(1H-indol-3-yl)ethyl]quinazolin-4-amine (PubChem CID 22692794) has the molecular formula C18H15ClN4 and a molecular weight of 322.80 g/mol. Its IUPAC name is 2-chloro-N-[2-(1H-indol-3-yl)ethyl]quinazolin-4-amine.
| Compound Name | 2-chloro-N-[2-(1H-indol-3-yl)ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 22692794 |
| Molecular Formula | C18H15ClN4 |
| Molecular Weight | 322.80 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 2-chloro-N-[2-(1H-indol-3-yl)ethyl]quinazolin-4-amine |
| SMILES | Clc1nc(NCCc2c[nH]c3ccccc23)c2ccccc2n1 |
| InChI | InChI=1S/C18H15ClN4/c19-18-22-16-8-4-2-6-14(16)17(23-18)20-10-9-12-11-21-15-7-3-1-5-13(12)15/h1-8,11,21H,9-10H2,(H,20,22,23) |
| InChIKey | KWXBYALTSIVETG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.80 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |