C16H13ClN4O — CID 146598277
2-chloro-N-[2-(1H-indol-3-yl)ethyl]furo[3,2-d]pyrimidin-4-amine (PubChem CID 146598277) has the molecular formula C16H13ClN4O and a molecular weight of 312.76 g/mol. Its IUPAC name is 2-chloro-N-[2-(1H-indol-3-yl)ethyl]furo[3,2-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-[2-(1H-indol-3-yl)ethyl]furo[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 146598277 |
| Molecular Formula | C16H13ClN4O |
| Molecular Weight | 312.76 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 2-chloro-N-[2-(1H-indol-3-yl)ethyl]furo[3,2-d]pyrimidin-4-amine |
| SMILES | Clc1nc(NCCc2c[nH]c3ccccc23)c2occc2n1 |
| InChI | InChI=1S/C16H13ClN4O/c17-16-20-13-6-8-22-14(13)15(21-16)18-7-5-10-9-19-12-4-2-1-3-11(10)12/h1-4,6,8-9,19H,5,7H2,(H,18,20,21) |
| InChIKey | AMLINGBYWIJIAT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.76 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |