C17H16N4 — CID 30033461
N-[2-(1H-indol-3-yl)ethyl]-1H-benzimidazol-2-amine (PubChem CID 30033461) has the molecular formula C17H16N4 and a molecular weight of 276.34 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-1H-benzimidazol-2-amine.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 30033461 |
| Molecular Formula | C17H16N4 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-1H-benzimidazol-2-amine |
| SMILES | c1ccc2[nH]c(NCCc3c[nH]c4ccccc34)nc2c1 |
| InChI | InChI=1S/C17H16N4/c1-2-6-14-13(5-1)12(11-19-14)9-10-18-17-20-15-7-3-4-8-16(15)21-17/h1-8,11,19H,9-10H2,(H2,18,20,21) |
| InChIKey | UOMGFKZTWBUWJF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 56.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |