C14H25N3 — CID 145154327
ethane;N-propyl-1H-benzimidazol-2-amine (PubChem CID 145154327) has the molecular formula C14H25N3 and a molecular weight of 235.38 g/mol. Its IUPAC name is ethane;N-propyl-1H-benzimidazol-2-amine.
| Compound Name | ethane;N-propyl-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 145154327 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.38 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | ethane;N-propyl-1H-benzimidazol-2-amine |
| SMILES | CC.CC.CCCNc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C10H13N3.2C2H6/c1-2-7-11-10-12-8-5-3-4-6-9(8)13-10;2*1-2/h3-6H,2,7H2,1H3,(H2,11,12,13);2*1-2H3 |
| InChIKey | NEZGSFRORGEJRN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |