C11H12F3N3 — CID 113327793
N-(4,4,4-trifluorobutyl)-1H-benzimidazol-2-amine (PubChem CID 113327793) has the molecular formula C11H12F3N3 and a molecular weight of 243.23 g/mol. Its IUPAC name is N-(4,4,4-trifluorobutyl)-1H-benzimidazol-2-amine.
| Compound Name | N-(4,4,4-trifluorobutyl)-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 113327793 |
| Molecular Formula | C11H12F3N3 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | N-(4,4,4-trifluorobutyl)-1H-benzimidazol-2-amine |
| SMILES | FC(F)(F)CCCNc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C11H12F3N3/c12-11(13,14)6-3-7-15-10-16-8-4-1-2-5-9(8)17-10/h1-2,4-5H,3,6-7H2,(H2,15,16,17) |
| InChIKey | YWKLWUSGGRDNAK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|