C12H18ClN3 — CID 174826614
N-pentyl-1H-benzimidazol-2-amine;hydrochloride (PubChem CID 174826614) has the molecular formula C12H18ClN3 and a molecular weight of 239.75 g/mol. Its IUPAC name is N-pentyl-1H-benzimidazol-2-amine;hydrochloride.
| Compound Name | N-pentyl-1H-benzimidazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 174826614 |
| Molecular Formula | C12H18ClN3 |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | N-pentyl-1H-benzimidazol-2-amine;hydrochloride |
| SMILES | CCCCCNc1nc2ccccc2[nH]1.Cl |
| InChI | InChI=1S/C12H17N3.ClH/c1-2-3-6-9-13-12-14-10-7-4-5-8-11(10)15-12;/h4-5,7-8H,2-3,6,9H2,1H3,(H2,13,14,15);1H |
| InChIKey | JPGJXXVGCJUSGY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|