C11H14IN3 — CID 162670767
N-butyl-6-iodo-1H-benzimidazol-2-amine (PubChem CID 162670767) has the molecular formula C11H14IN3 and a molecular weight of 315.16 g/mol. Its IUPAC name is N-butyl-6-iodo-1H-benzimidazol-2-amine.
| Compound Name | N-butyl-6-iodo-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 162670767 |
| Molecular Formula | C11H14IN3 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | N-butyl-6-iodo-1H-benzimidazol-2-amine |
| SMILES | CCCCNc1nc2ccc(I)cc2[nH]1 |
| InChI | InChI=1S/C11H14IN3/c1-2-3-6-13-11-14-9-5-4-8(12)7-10(9)15-11/h4-5,7H,2-3,6H2,1H3,(H2,13,14,15) |
| InChIKey | HOPIFHWBEHOUPG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|