C9H12N3P — CID 162722217
N-ethyl-6-phosphanyl-1H-benzimidazol-2-amine (PubChem CID 162722217) has the molecular formula C9H12N3P and a molecular weight of 193.19 g/mol. Its IUPAC name is N-ethyl-6-phosphanyl-1H-benzimidazol-2-amine.
| Compound Name | N-ethyl-6-phosphanyl-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 162722217 |
| Molecular Formula | C9H12N3P |
| Molecular Weight | 193.19 g/mol |
| Exact Mass | 193.08 |
| IUPAC Name | N-ethyl-6-phosphanyl-1H-benzimidazol-2-amine |
| SMILES | CCNc1nc2ccc(P)cc2[nH]1 |
| InChI | InChI=1S/C9H12N3P/c1-2-10-9-11-7-4-3-6(13)5-8(7)12-9/h3-5H,2,13H2,1H3,(H2,10,11,12) |
| InChIKey | FKEJKOHBIFATTR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|