C13H20N4 — CID 106328017
2-N-(3-methylpentan-3-yl)-3H-benzimidazole-2,5-diamine (PubChem CID 106328017) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is 2-N-(3-methylpentan-3-yl)-3H-benzimidazole-2,5-diamine.
| Compound Name | 2-N-(3-methylpentan-3-yl)-3H-benzimidazole-2,5-diamine |
|---|---|
| PubChem CID | 106328017 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 2-N-(3-methylpentan-3-yl)-3H-benzimidazole-2,5-diamine |
| SMILES | CCC(C)(CC)Nc1nc2ccc(N)cc2[nH]1 |
| InChI | InChI=1S/C13H20N4/c1-4-13(3,5-2)17-12-15-10-7-6-9(14)8-11(10)16-12/h6-8H,4-5,14H2,1-3H3,(H2,15,16,17) |
| InChIKey | JPUPKXPQMBJZTM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|