C15H22N4O — CID 103965451
[1-[[(6-amino-1H-benzimidazol-2-yl)amino]methyl]cyclohexyl]methanol (PubChem CID 103965451) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is [1-[[(6-amino-1H-benzimidazol-2-yl)amino]methyl]cyclohexyl]methanol.
| Compound Name | [1-[[(6-amino-1H-benzimidazol-2-yl)amino]methyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 103965451 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | [1-[[(6-amino-1H-benzimidazol-2-yl)amino]methyl]cyclohexyl]methanol |
| SMILES | Nc1ccc2nc(NCC3(CO)CCCCC3)[nH]c2c1 |
| InChI | InChI=1S/C15H22N4O/c16-11-4-5-12-13(8-11)19-14(18-12)17-9-15(10-20)6-2-1-3-7-15/h4-5,8,20H,1-3,6-7,9-10,16H2,(H2,17,18,19) |
| InChIKey | KOPIMTBJVPRKHV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|